About CID 171048247
CID 171048247 (PubChem CID 171048247) has the molecular formula C70H48N4O2Pt-2
and a molecular weight of 1177.29 g/mol.
Molecular Properties
| Compound Name | CID 171048247 |
| PubChem CID | 171048247 |
| Molecular Formula | C70H48N4O2Pt-2 |
| Molecular Weight | 1177.29 g/mol |
| Exact Mass | 1176.37 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2ccccc2-c2cccc4c2[n+]([c-]n4-c2[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc2)-c2c(-c4ccc5c(c4)C4=CC=CCC4O5)cccc2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C70H48N4O2.Pt/c1-70(2,3)46-37-38-71-66(40-46)74-61-30-11-9-22-53(61)54-35-34-49(42-63(54)74)75-48-20-13-19-47(41-48)72-43-73-68-51(45-33-36-65-60(39-45)55-23-10-12-32-64(55)76-65)26-15-28-59(68)57-27-14-25-50(44-17-5-4-6-18-44)67(57)56-24-8-7-21-52(56)58-29-16-31-62(72)69(58)73;/h4-31,33-40,64H,32H2,1-3H3;/q-2;/i4D,5D,6D,17D,18D; |
| InChIKey | VGXUPNWUGABCBP-OPYOEAFXSA-N |
| XLogP | 16.64 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1177.29 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 171048247 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171048247?
The IUPAC name of CID 171048247 (CID 171048247) is not available.
What is the SMILES notation for CID 171048247?
The canonical SMILES for CID 171048247 is [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2ccccc2-c2cccc4c2[n+]([c-]n4-c2[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc2)-c2c(-c4ccc5c(c4)C4=CC=CCC4O5)cccc2-3)c([2H])c1[2H].[Pt].
What is the InChIKey of CID 171048247?
The InChIKey is VGXUPNWUGABCBP-OPYOEAFXSA-N. The full InChI is InChI=1S/C70H48N4O2.Pt/c1-70(2,3)46-37-38-71-66(40-46)74-61-30-11-9-22-53(61)54-35-34-49(42-63(54)74)75-48-20-13-19-47(41-48)72-43-73-68-51(45-33-36-65-60(39-45)55-23-10-12-32-64(55)76-65)26-15-28-59(68)57-27-14-25-50(44-17-5-4-6-18-44)67(57)56-24-8-7-21-52(56)58-29-16-31-62(72)69(58)73;/h4-31,33-40,64H,32H2,1-3H3;/q-2;/i4D,5D,6D,17D,18D;.
What are the key properties of CID 171048247?
CID 171048247 has a molecular weight of 1177.29 g/mol, XLogP of 16.64, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171048247 is sourced from PubChem (CID 171048247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).