C80H70N4O — CID 171048278
CID 171048278 (PubChem CID 171048278) has the molecular formula C80H70N4O and a molecular weight of 1114.53 g/mol.
| Compound Name | CID 171048278 |
|---|---|
| PubChem CID | 171048278 |
| Molecular Formula | C80H70N4O |
| Molecular Weight | 1114.53 g/mol |
| Exact Mass | 1113.62 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2cc(-c4c(C([2H])([2H])[2H])cccc4C([2H])([2H])[2H])cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c2-[n+]2[c-]n(-c4cccc(Oc5ccc6c7ccccc7n(-c7cc(C(C)(C)C)ccn7)c6c5)c4)c4cccc(c42)-c2ccccc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C80H70N4O/c1-50-23-19-24-51(2)74(50)54-43-68(53-41-56(79(6,7)8)45-57(42-53)80(9,10)11)76-69(44-54)75-61(52-25-13-12-14-26-52)32-21-33-66(75)62-29-15-16-30-63(62)67-34-22-36-71-77(67)83(76)49-82(71)58-27-20-28-59(47-58)85-60-37-38-65-64-31-17-18-35-70(64)84(72(65)48-60)73-46-55(39-40-81-73)78(3,4)5/h12-48H,1-11H3/i1D3,2D3,12D,13D,14D,25D,26D |
| InChIKey | LLDQSOXPTXEFRF-BQHSALHRSA-N |
| XLogP | 20.82 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.53 |
| LogP ≤ 5 | 20.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|