C16H13ClF3N5O2 — CID 171048676
2-chloro-N-[2-[(1-isocyanocyclopropyl)methylamino]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide (PubChem CID 171048676) has the molecular formula C16H13ClF3N5O2 and a molecular weight of 399.76 g/mol. Its IUPAC name is 2-chloro-N-[2-[(1-isocyanocyclopropyl)methylamino]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-[(1-isocyanocyclopropyl)methylamino]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 171048676 |
| Molecular Formula | C16H13ClF3N5O2 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-chloro-N-[2-[(1-isocyanocyclopropyl)methylamino]-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
| SMILES | [C-]#[N+]C1(CNc2ccc(-c3noc(C(F)(F)F)n3)cc2NC(=O)CCl)CC1 |
| InChI | InChI=1S/C16H13ClF3N5O2/c1-21-15(4-5-15)8-22-10-3-2-9(6-11(10)23-12(26)7-17)13-24-14(27-25-13)16(18,19)20/h2-3,6,22H,4-5,7-8H2,(H,23,26) |
| InChIKey | GNUCOTHZOWQQKR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|