C24H36O2P2 — CID 171050822
2,2,6,6-tetramethyl-1-[2-(2,2,6,6-tetramethyl-4-oxophosphinan-1-yl)phenyl]phosphinan-4-one (PubChem CID 171050822) has the molecular formula C24H36O2P2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[2-(2,2,6,6-tetramethyl-4-oxophosphinan-1-yl)phenyl]phosphinan-4-one.
| Compound Name | 2,2,6,6-tetramethyl-1-[2-(2,2,6,6-tetramethyl-4-oxophosphinan-1-yl)phenyl]phosphinan-4-one |
|---|---|
| PubChem CID | 171050822 |
| Molecular Formula | C24H36O2P2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[2-(2,2,6,6-tetramethyl-4-oxophosphinan-1-yl)phenyl]phosphinan-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)P1c1ccccc1P1C(C)(C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C24H36O2P2/c1-21(2)13-17(25)14-22(3,4)27(21)19-11-9-10-12-20(19)28-23(5,6)15-18(26)16-24(28,7)8/h9-12H,13-16H2,1-8H3 |
| InChIKey | OQPPWERZFRGCAR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|