C25H48O2P2 — CID 171050857
(4R,5R)-2,2-dimethyl-4,5-bis[(2,2,6,6-tetramethylphosphinan-1-yl)methyl]-1,3-dioxolane (PubChem CID 171050857) has the molecular formula C25H48O2P2 and a molecular weight of 442.61 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-bis[(2,2,6,6-tetramethylphosphinan-1-yl)methyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-bis[(2,2,6,6-tetramethylphosphinan-1-yl)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 171050857 |
| Molecular Formula | C25H48O2P2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-bis[(2,2,6,6-tetramethylphosphinan-1-yl)methyl]-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](CP2C(C)(C)CCCC2(C)C)[C@H](CP2C(C)(C)CCCC2(C)C)O1 |
| InChI | InChI=1S/C25H48O2P2/c1-21(2)13-11-14-22(3,4)28(21)17-19-20(27-25(9,10)26-19)18-29-23(5,6)15-12-16-24(29,7)8/h19-20H,11-18H2,1-10H3/t19-,20-/m0/s1 |
| InChIKey | WRSKKLLNUJCFHO-PMACEKPBSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|