C20H20F3NO6S — CID 171051159
[1,3-dioxo-6-(1-propan-2-yloxybutyl)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 171051159) has the molecular formula C20H20F3NO6S and a molecular weight of 459.44 g/mol. Its IUPAC name is [1,3-dioxo-6-(1-propan-2-yloxybutyl)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [1,3-dioxo-6-(1-propan-2-yloxybutyl)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171051159 |
| Molecular Formula | C20H20F3NO6S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [1,3-dioxo-6-(1-propan-2-yloxybutyl)benzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CCCC(OC(C)C)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C20H20F3NO6S/c1-4-6-16(29-11(2)3)12-9-10-15-17-13(12)7-5-8-14(17)18(25)24(19(15)26)30-31(27,28)20(21,22)23/h5,7-11,16H,4,6H2,1-3H3 |
| InChIKey | CIHURUWWSMIMRG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|