C19H18F3NO6S — CID 171051171
[6-(1-butoxyethyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate (PubChem CID 171051171) has the molecular formula C19H18F3NO6S and a molecular weight of 445.42 g/mol. Its IUPAC name is [6-(1-butoxyethyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(1-butoxyethyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171051171 |
| Molecular Formula | C19H18F3NO6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [6-(1-butoxyethyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCOC(C)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C19H18F3NO6S/c1-3-4-10-28-11(2)12-8-9-15-16-13(12)6-5-7-14(16)17(24)23(18(15)25)29-30(26,27)19(20,21)22/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | KGLNJHLJGJHHEI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|