C24H25N3O2 — CID 171051525
N-[(1R)-1-[3-(2-cyclopropylethynyl)phenyl]ethyl]-6,7-dimethoxy-2-methylquinazolin-4-amine (PubChem CID 171051525) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2-cyclopropylethynyl)phenyl]ethyl]-6,7-dimethoxy-2-methylquinazolin-4-amine.
| Compound Name | N-[(1R)-1-[3-(2-cyclopropylethynyl)phenyl]ethyl]-6,7-dimethoxy-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 171051525 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[(1R)-1-[3-(2-cyclopropylethynyl)phenyl]ethyl]-6,7-dimethoxy-2-methylquinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(N[C@H](C)c3cccc(C#CC4CC4)c3)c2cc1OC |
| InChI | InChI=1S/C24H25N3O2/c1-15(19-7-5-6-18(12-19)11-10-17-8-9-17)25-24-20-13-22(28-3)23(29-4)14-21(20)26-16(2)27-24/h5-7,12-15,17H,8-9H2,1-4H3,(H,25,26,27)/t15-/m1/s1 |
| InChIKey | HLQYCIPBEWSXBM-OAHLLOKOSA-N |
| XLogP | 4.89 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|