C54H60F3N5O — CID 171052032
2,4-ditert-butyl-6-[4-tert-butyl-6-[3-[2-(1,1-dideuterio-2,2,2-trifluoroethyl)-7-[4-phenyl-2,6-di(propan-2-yl)phenyl]purin-8-yl]phenyl]-2-pyridinyl]phenol (PubChem CID 171052032) has the molecular formula C54H60F3N5O and a molecular weight of 854.11 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-[2-(1,1-dideuterio-2,2,2-trifluoroethyl)-7-[4-phenyl-2,6-di(propan-2-yl)phenyl]purin-8-yl]phenyl]-2-pyridinyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-[2-(1,1-dideuterio-2,2,2-trifluoroethyl)-7-[4-phenyl-2,6-di(propan-2-yl)phenyl]purin-8-yl]phenyl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 171052032 |
| Molecular Formula | C54H60F3N5O |
| Molecular Weight | 854.11 g/mol |
| Exact Mass | 853.49 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-tert-butyl-6-[3-[2-(1,1-dideuterio-2,2,2-trifluoroethyl)-7-[4-phenyl-2,6-di(propan-2-yl)phenyl]purin-8-yl]phenyl]-2-pyridinyl]phenol |
| SMILES | [2H]C([2H])(c1ncc2c(n1)nc(-c1cccc(-c3cc(C(C)(C)C)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)n3)c1)n2-c1c(C(C)C)cc(-c2ccccc2)cc1C(C)C)C(F)(F)F |
| InChI | InChI=1S/C54H60F3N5O/c1-31(2)39-23-36(33-18-15-14-16-19-33)24-40(32(3)4)47(39)62-45-30-58-46(29-54(55,56)57)60-49(45)61-50(62)35-21-17-20-34(22-35)43-27-38(52(8,9)10)28-44(59-43)41-25-37(51(5,6)7)26-42(48(41)63)53(11,12)13/h14-28,30-32,63H,29H2,1-13H3/i29D2 |
| InChIKey | UARRJRPSSTZXPO-DNBURNPGSA-N |
| XLogP | 14.83 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.11 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |