C18H18N6 — CID 171053449
2-(4-methylpiperazin-1-yl)-6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaene (PubChem CID 171053449) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaene.
| Compound Name | 2-(4-methylpiperazin-1-yl)-6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 171053449 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-6,9,14,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11(16),12,14-octaene |
| SMILES | CN1CCN(c2c3ccncc3nc3c2[nH]c2cnccc23)CC1 |
| InChI | InChI=1S/C18H18N6/c1-23-6-8-24(9-7-23)18-13-3-5-20-11-15(13)21-16-12-2-4-19-10-14(12)22-17(16)18/h2-5,10-11,22H,6-9H2,1H3 |
| InChIKey | KXYXWEBCESCSAU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |