C33H23F3N2O5 — CID 171053531
6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]-4-(3,3,3-trifluoropropyl)isoindole-1,3-dione (PubChem CID 171053531) has the molecular formula C33H23F3N2O5 and a molecular weight of 584.55 g/mol. Its IUPAC name is 6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]-4-(3,3,3-trifluoropropyl)isoindole-1,3-dione.
| Compound Name | 6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]-4-(3,3,3-trifluoropropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 171053531 |
| Molecular Formula | C33H23F3N2O5 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]-4-(3,3,3-trifluoropropyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4cc(-c5ccc6c(c5)C(=O)N(C)C6=O)cc(CCC(F)(F)F)c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C33H23F3N2O5/c1-18-3-8-23(9-4-18)43-24-10-6-22(7-11-24)38-31(41)27-17-21(15-20(28(27)32(38)42)13-14-33(34,35)36)19-5-12-25-26(16-19)30(40)37(2)29(25)39/h3-12,15-17H,13-14H2,1-2H3 |
| InChIKey | ZAXRFJFQDDQDRW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|