C32H22F2N2O5 — CID 171053533
4-(2,2-difluoroethyl)-6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]isoindole-1,3-dione (PubChem CID 171053533) has the molecular formula C32H22F2N2O5 and a molecular weight of 552.53 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]isoindole-1,3-dione.
| Compound Name | 4-(2,2-difluoroethyl)-6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171053533 |
| Molecular Formula | C32H22F2N2O5 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 4-(2,2-difluoroethyl)-6-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[4-(4-methylphenoxy)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4cc(-c5ccc6c(c5)C(=O)N(C)C6=O)cc(CC(F)F)c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C32H22F2N2O5/c1-17-3-8-22(9-4-17)41-23-10-6-21(7-11-23)36-31(39)26-15-19(13-20(16-27(33)34)28(26)32(36)40)18-5-12-24-25(14-18)30(38)35(2)29(24)37/h3-15,27H,16H2,1-2H3 |
| InChIKey | URJXEXKJWHSXNT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|