C20H22INO2 — CID 171053918
N-[(1R)-1-cyclobutyl-2-(3-methoxyphenyl)ethyl]-4-iodobenzamide (PubChem CID 171053918) has the molecular formula C20H22INO2 and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[(1R)-1-cyclobutyl-2-(3-methoxyphenyl)ethyl]-4-iodobenzamide.
| Compound Name | N-[(1R)-1-cyclobutyl-2-(3-methoxyphenyl)ethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 171053918 |
| Molecular Formula | C20H22INO2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[(1R)-1-cyclobutyl-2-(3-methoxyphenyl)ethyl]-4-iodobenzamide |
| SMILES | COc1cccc(C[C@@H](NC(=O)c2ccc(I)cc2)C2CCC2)c1 |
| InChI | InChI=1S/C20H22INO2/c1-24-18-7-2-4-14(12-18)13-19(15-5-3-6-15)22-20(23)16-8-10-17(21)11-9-16/h2,4,7-12,15,19H,3,5-6,13H2,1H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | YXSSKVKASYWODG-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|