About 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide
2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide (PubChem CID 171055458) has the molecular formula C14H11N5O3S2
and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 171055458 |
| Molecular Formula | C14H11N5O3S2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2nc(C(N)=O)cs2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C14H11N5O3S2/c1-7-2-3-9(12-11(7)8(4-15)5-17-12)19-24(21,22)14-18-10(6-23-14)13(16)20/h2-3,5-6,17,19H,1H3,(H2,16,20) |
| InChIKey | BVWSEYKLNBMELL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide (CID 171055458) is 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide is Cc1ccc(NS(=O)(=O)c2nc(C(N)=O)cs2)c2[nH]cc(C#N)c12.
What is the InChIKey of 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide?
The InChIKey is BVWSEYKLNBMELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O3S2/c1-7-2-3-9(12-11(7)8(4-15)5-17-12)19-24(21,22)14-18-10(6-23-14)13(16)20/h2-3,5-6,17,19H,1H3,(H2,16,20).
What are the key properties of 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide?
2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide has a molecular weight of 361.41 g/mol, XLogP of 1.70, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 171055458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).