C9H16O9P- — CID 171055781
[(2R,3R,4S,5R)-3,4-dihydroxy-5-(2-methylpropanoyloxymethyl)oxolan-2-yl] hydrogen phosphate (PubChem CID 171055781) has the molecular formula C9H16O9P- and a molecular weight of 299.19 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-dihydroxy-5-(2-methylpropanoyloxymethyl)oxolan-2-yl] hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-3,4-dihydroxy-5-(2-methylpropanoyloxymethyl)oxolan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 171055781 |
| Molecular Formula | C9H16O9P- |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-dihydroxy-5-(2-methylpropanoyloxymethyl)oxolan-2-yl] hydrogen phosphate |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@H](OP(=O)([O-])O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17O9P/c1-4(2)8(12)16-3-5-6(10)7(11)9(17-5)18-19(13,14)15/h4-7,9-11H,3H2,1-2H3,(H2,13,14,15)/p-1/t5-,6-,7-,9-/m1/s1 |
| InChIKey | FLMYCTXVWDOLTM-JXOAFFINSA-M |
| XLogP | -1.89 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|