C28H25NOSi — CID 171056269
[3-[3-[4-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 171056269) has the molecular formula C28H25NOSi and a molecular weight of 419.60 g/mol. Its IUPAC name is [3-[3-[4-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [3-[3-[4-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 171056269 |
| Molecular Formula | C28H25NOSi |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [3-[3-[4-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc(-c2cccc(-c3ccc(-c4nc5ccccc5o4)cc3)c2)c1 |
| InChI | InChI=1S/C28H25NOSi/c1-31(2,3)25-11-7-10-24(19-25)23-9-6-8-22(18-23)20-14-16-21(17-15-20)28-29-26-12-4-5-13-27(26)30-28/h4-19H,1-3H3 |
| InChIKey | XPCSLROXKCBBMZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|