C26H14F6S — CID 171056317
2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]dibenzothiophene (PubChem CID 171056317) has the molecular formula C26H14F6S and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]dibenzothiophene.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 171056317 |
| Molecular Formula | C26H14F6S |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]dibenzothiophene |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccc4sc5ccccc5c4c3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H14F6S/c27-25(28,29)19-11-18(12-20(14-19)26(30,31)32)16-7-5-15(6-8-16)17-9-10-24-22(13-17)21-3-1-2-4-23(21)33-24/h1-14H |
| InChIKey | NUIRGMKVUJUWJR-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |