C34H29NSi — CID 171056328
trimethyl-[4-[4-(6-quinolin-2-ylnaphthalen-2-yl)phenyl]phenyl]silane (PubChem CID 171056328) has the molecular formula C34H29NSi and a molecular weight of 479.70 g/mol. Its IUPAC name is trimethyl-[4-[4-(6-quinolin-2-ylnaphthalen-2-yl)phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-(6-quinolin-2-ylnaphthalen-2-yl)phenyl]phenyl]silane |
|---|---|
| PubChem CID | 171056328 |
| Molecular Formula | C34H29NSi |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | trimethyl-[4-[4-(6-quinolin-2-ylnaphthalen-2-yl)phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc4cc(-c5ccc6ccccc6n5)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C34H29NSi/c1-36(2,3)32-19-16-25(17-20-32)24-8-10-26(11-9-24)28-12-13-30-23-31(15-14-29(30)22-28)34-21-18-27-6-4-5-7-33(27)35-34/h4-23H,1-3H3 |
| InChIKey | DCDFGIYFXYGANK-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|