C12H10ClF3N2 — CID 171056952
2-[4-[chloro(dideuterio)methyl]phenyl]-1-(trideuteriomethyl)-4-(trifluoromethyl)imidazole (PubChem CID 171056952) has the molecular formula C12H10ClF3N2 and a molecular weight of 279.70 g/mol. Its IUPAC name is 2-[4-[chloro(dideuterio)methyl]phenyl]-1-(trideuteriomethyl)-4-(trifluoromethyl)imidazole.
| Compound Name | 2-[4-[chloro(dideuterio)methyl]phenyl]-1-(trideuteriomethyl)-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 171056952 |
| Molecular Formula | C12H10ClF3N2 |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[4-[chloro(dideuterio)methyl]phenyl]-1-(trideuteriomethyl)-4-(trifluoromethyl)imidazole |
| SMILES | [2H]C([2H])(Cl)c1ccc(-c2nc(C(F)(F)F)cn2C([2H])([2H])[2H])cc1 |
| InChI | InChI=1S/C12H10ClF3N2/c1-18-7-10(12(14,15)16)17-11(18)9-4-2-8(6-13)3-5-9/h2-5,7H,6H2,1H3/i1D3,6D2 |
| InChIKey | YPFNXASBVZHBHX-YRYIGFSMSA-N |
| XLogP | 3.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|