About 4,8-diethyl-1,5-dioxocane-2,6-dione
4,8-diethyl-1,5-dioxocane-2,6-dione (PubChem CID 171057524) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 4,8-diethyl-1,5-dioxocane-2,6-dione.
Molecular Properties
| Compound Name | 4,8-diethyl-1,5-dioxocane-2,6-dione |
| PubChem CID | 171057524 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4,8-diethyl-1,5-dioxocane-2,6-dione |
| SMILES | CCC1CC(=O)OC(CC)CC(=O)O1 |
| InChI | InChI=1S/C10H16O4/c1-3-7-5-9(11)14-8(4-2)6-10(12)13-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | YUXYRVCOORBROH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,8-diethyl-1,5-dioxocane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-diethyl-1,5-dioxocane-2,6-dione?
The IUPAC name of 4,8-diethyl-1,5-dioxocane-2,6-dione (CID 171057524) is 4,8-diethyl-1,5-dioxocane-2,6-dione.
What is the SMILES notation for 4,8-diethyl-1,5-dioxocane-2,6-dione?
The canonical SMILES for 4,8-diethyl-1,5-dioxocane-2,6-dione is CCC1CC(=O)OC(CC)CC(=O)O1.
What is the InChIKey of 4,8-diethyl-1,5-dioxocane-2,6-dione?
The InChIKey is YUXYRVCOORBROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-3-7-5-9(11)14-8(4-2)6-10(12)13-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 4,8-diethyl-1,5-dioxocane-2,6-dione?
4,8-diethyl-1,5-dioxocane-2,6-dione has a molecular weight of 200.23 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-diethyl-1,5-dioxocane-2,6-dione is sourced from PubChem (CID 171057524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).