C15H21BClF3N6O3 — CID 171057999
[5-amino-5-[1-[2-oxo-2-[(2,4,6-trifluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride (PubChem CID 171057999) has the molecular formula C15H21BClF3N6O3 and a molecular weight of 436.63 g/mol. Its IUPAC name is [5-amino-5-[1-[2-oxo-2-[(2,4,6-trifluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride.
| Compound Name | [5-amino-5-[1-[2-oxo-2-[(2,4,6-trifluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 171057999 |
| Molecular Formula | C15H21BClF3N6O3 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [5-amino-5-[1-[2-oxo-2-[(2,4,6-trifluorophenyl)methylamino]ethyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(CCCCB(O)O)c1nnnn1CC(=O)NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H20BF3N6O3.ClH/c17-9-5-11(18)10(12(19)6-9)7-21-14(26)8-25-15(22-23-24-25)13(20)3-1-2-4-16(27)28;/h5-6,13,27-28H,1-4,7-8,20H2,(H,21,26);1H |
| InChIKey | IPYAYUWJHKHCEP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|