C17H23NO4 — CID 171058124
[(3aR,5S,6S,6aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 171058124) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5S,6S,6aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 171058124 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [(3aR,5S,6S,6aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CC1(C)O[C@H]2O[C@H](CO)[C@H](N3CCc4ccccc4C3)[C@H]2O1 |
| InChI | InChI=1S/C17H23NO4/c1-17(2)21-15-14(13(10-19)20-16(15)22-17)18-8-7-11-5-3-4-6-12(11)9-18/h3-6,13-16,19H,7-10H2,1-2H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | VVQWEDPSSFAJNT-QKPAOTATSA-N |
| XLogP | 1.28 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |