C17H28F6N2O7S2Si — CID 171058218
bis(trifluoromethylsulfonyl)azanide;triethoxy-[3-(3-methylpyridin-1-ium-1-yl)propyl]silane (PubChem CID 171058218) has the molecular formula C17H28F6N2O7S2Si and a molecular weight of 578.63 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;triethoxy-[3-(3-methylpyridin-1-ium-1-yl)propyl]silane.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;triethoxy-[3-(3-methylpyridin-1-ium-1-yl)propyl]silane |
|---|---|
| PubChem CID | 171058218 |
| Molecular Formula | C17H28F6N2O7S2Si |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;triethoxy-[3-(3-methylpyridin-1-ium-1-yl)propyl]silane |
| SMILES | CCO[Si](CCC[n+]1cccc(C)c1)(OCC)OCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H28NO3Si.C2F6NO4S2/c1-5-17-20(18-6-2,19-7-3)13-9-12-16-11-8-10-15(4)14-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8,10-11,14H,5-7,9,12-13H2,1-4H3;/q+1;-1 |
| InChIKey | LYFWYVUTUIEOFS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|