About 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid
2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid (PubChem CID 171058727) has the molecular formula C21H21ClN4O4
and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid |
| PubChem CID | 171058727 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid |
| SMILES | CCCC#Cc1nc(Cl)c2nc(-c3ccc(C)o3)n([C@@H]3OCC[C@@H]3CC(=O)O)c2n1 |
| InChI | InChI=1S/C21H21ClN4O4/c1-3-4-5-6-15-23-18(22)17-20(24-15)26(19(25-17)14-8-7-12(2)30-14)21-13(9-10-29-21)11-16(27)28/h7-8,13,21H,3-4,9-11H2,1-2H3,(H,27,28)/t13-,21-/m1/s1 |
| InChIKey | RJHSQNBKZFGTNW-LRTDBIEQSA-N |
| XLogP | 4.21 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid?
The IUPAC name of 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid (CID 171058727) is 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid.
What is the SMILES notation for 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid?
The canonical SMILES for 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid is CCCC#Cc1nc(Cl)c2nc(-c3ccc(C)o3)n([C@@H]3OCC[C@@H]3CC(=O)O)c2n1.
What is the InChIKey of 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid?
The InChIKey is RJHSQNBKZFGTNW-LRTDBIEQSA-N. The full InChI is InChI=1S/C21H21ClN4O4/c1-3-4-5-6-15-23-18(22)17-20(24-15)26(19(25-17)14-8-7-12(2)30-14)21-13(9-10-29-21)11-16(27)28/h7-8,13,21H,3-4,9-11H2,1-2H3,(H,27,28)/t13-,21-/m1/s1.
What are the key properties of 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid?
2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid has a molecular weight of 428.88 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-2-[6-chloro-8-(5-methylfuran-2-yl)-2-pent-1-ynylpurin-9-yl]oxolan-3-yl]acetic acid is sourced from PubChem (CID 171058727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).