About 3-fluoronona-1,8-diyne
3-fluoronona-1,8-diyne (PubChem CID 171059089) has the molecular formula C9H11F
and a molecular weight of 138.19 g/mol. Its IUPAC name is 3-fluoronona-1,8-diyne.
Molecular Properties
| Compound Name | 3-fluoronona-1,8-diyne |
| PubChem CID | 171059089 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-fluoronona-1,8-diyne |
| SMILES | C#CCCCCC(F)C#C |
| InChI | InChI=1S/C9H11F/c1-3-5-6-7-8-9(10)4-2/h1-2,9H,5-8H2 |
| InChIKey | LNBJVZFMBXTYKD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoronona-1,8-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoronona-1,8-diyne?
The IUPAC name of 3-fluoronona-1,8-diyne (CID 171059089) is 3-fluoronona-1,8-diyne.
What is the SMILES notation for 3-fluoronona-1,8-diyne?
The canonical SMILES for 3-fluoronona-1,8-diyne is C#CCCCCC(F)C#C.
What is the InChIKey of 3-fluoronona-1,8-diyne?
The InChIKey is LNBJVZFMBXTYKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F/c1-3-5-6-7-8-9(10)4-2/h1-2,9H,5-8H2.
What are the key properties of 3-fluoronona-1,8-diyne?
3-fluoronona-1,8-diyne has a molecular weight of 138.19 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoronona-1,8-diyne is sourced from PubChem (CID 171059089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).