C22H31N3O5 — CID 171059116
N-cyclohexyl-N-[(E)-3-[(2-nitrophenyl)carbamoyloxy]prop-1-enyl]cyclohexanamine oxide (PubChem CID 171059116) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-cyclohexyl-N-[(E)-3-[(2-nitrophenyl)carbamoyloxy]prop-1-enyl]cyclohexanamine oxide.
| Compound Name | N-cyclohexyl-N-[(E)-3-[(2-nitrophenyl)carbamoyloxy]prop-1-enyl]cyclohexanamine oxide |
|---|---|
| PubChem CID | 171059116 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-cyclohexyl-N-[(E)-3-[(2-nitrophenyl)carbamoyloxy]prop-1-enyl]cyclohexanamine oxide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])OC/C=C/[N+]([O-])(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H31N3O5/c26-22(23-20-14-7-8-15-21(20)24(27)28)30-17-9-16-25(29,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h7-9,14-16,18-19H,1-6,10-13,17H2,(H,23,26)/b16-9+ |
| InChIKey | LJXNJKBZFZPTCB-CXUHLZMHSA-N |
| XLogP | 5.64 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|