C21H25BO7 — CID 171059419
4,6,7-trimethoxy-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one (PubChem CID 171059419) has the molecular formula C21H25BO7 and a molecular weight of 400.24 g/mol. Its IUPAC name is 4,6,7-trimethoxy-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | 4,6,7-trimethoxy-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 171059419 |
| Molecular Formula | C21H25BO7 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4,6,7-trimethoxy-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one |
| SMILES | COc1cc2c(OC)c3c(c(B4OC(C)(C)C(C)(C)O4)c2cc1OC)COC3=O |
| InChI | InChI=1S/C21H25BO7/c1-20(2)21(3,4)29-22(28-20)17-11-8-14(24-5)15(25-6)9-12(11)18(26-7)16-13(17)10-27-19(16)23/h8-9H,10H2,1-7H3 |
| InChIKey | NFSZRBXWGMHIGN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|