C20H31BClNO3 — CID 171059519
1-[5-(3,6-dihydro-2H-pyran-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride (PubChem CID 171059519) has the molecular formula C20H31BClNO3 and a molecular weight of 379.74 g/mol. Its IUPAC name is 1-[5-(3,6-dihydro-2H-pyran-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride.
| Compound Name | 1-[5-(3,6-dihydro-2H-pyran-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171059519 |
| Molecular Formula | C20H31BClNO3 |
| Molecular Weight | 379.74 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[5-(3,6-dihydro-2H-pyran-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)Cc1cc(C2=CCOCC2)ccc1B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C20H30BNO3.ClH/c1-19(2)20(3,4)25-21(24-19)18-8-7-16(13-17(18)14-22(5)6)15-9-11-23-12-10-15;/h7-9,13H,10-12,14H2,1-6H3;1H |
| InChIKey | DMWAZBGELQTHOT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|