C19H16F18O5 — CID 171059780
[2,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 171059780) has the molecular formula C19H16F18O5 and a molecular weight of 666.30 g/mol. Its IUPAC name is [2,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171059780 |
| Molecular Formula | C19H16F18O5 |
| Molecular Weight | 666.30 g/mol |
| Exact Mass | 666.07 |
| IUPAC Name | [2,4,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)CC1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H16F18O5/c1-5(2)10(38)42-9-7(12(40,16(26,27)28)17(29,30)31)3-6(11(39,14(20,21)22)15(23,24)25)4-8(9)13(41,18(32,33)34)19(35,36)37/h6-9,39-41H,1,3-4H2,2H3 |
| InChIKey | HMGSGKYVQSWLGK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|