About 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine
2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine (PubChem CID 171060700) has the molecular formula C12H13FN2
and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine |
| PubChem CID | 171060700 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine |
| SMILES | CN(C)n1cccc1-c1ccccc1F |
| InChI | InChI=1S/C12H13FN2/c1-14(2)15-9-5-8-12(15)10-6-3-4-7-11(10)13/h3-9H,1-2H3 |
| InChIKey | IHKGVCVOYROGFS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine?
The IUPAC name of 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine (CID 171060700) is 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine.
What is the SMILES notation for 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine?
The canonical SMILES for 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine is CN(C)n1cccc1-c1ccccc1F.
What is the InChIKey of 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine?
The InChIKey is IHKGVCVOYROGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2/c1-14(2)15-9-5-8-12(15)10-6-3-4-7-11(10)13/h3-9H,1-2H3.
What are the key properties of 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine?
2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine has a molecular weight of 204.25 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-N,N-dimethylpyrrol-1-amine is sourced from PubChem (CID 171060700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).