C21H22FN7O2 — CID 171060736
4-fluoro-2-[(1R)-1-[[3-[1-[(1R,3R)-3-hydroxycyclopentyl]triazol-4-yl]imidazo[1,2-b]pyridazin-6-yl]amino]ethyl]phenol (PubChem CID 171060736) has the molecular formula C21H22FN7O2 and a molecular weight of 423.45 g/mol. Its IUPAC name is 4-fluoro-2-[(1R)-1-[[3-[1-[(1R,3R)-3-hydroxycyclopentyl]triazol-4-yl]imidazo[1,2-b]pyridazin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-fluoro-2-[(1R)-1-[[3-[1-[(1R,3R)-3-hydroxycyclopentyl]triazol-4-yl]imidazo[1,2-b]pyridazin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 171060736 |
| Molecular Formula | C21H22FN7O2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-fluoro-2-[(1R)-1-[[3-[1-[(1R,3R)-3-hydroxycyclopentyl]triazol-4-yl]imidazo[1,2-b]pyridazin-6-yl]amino]ethyl]phenol |
| SMILES | C[C@@H](Nc1ccc2ncc(-c3cn([C@@H]4CC[C@@H](O)C4)nn3)n2n1)c1cc(F)ccc1O |
| InChI | InChI=1S/C21H22FN7O2/c1-12(16-8-13(22)2-5-19(16)31)24-20-6-7-21-23-10-18(29(21)26-20)17-11-28(27-25-17)14-3-4-15(30)9-14/h2,5-8,10-12,14-15,30-31H,3-4,9H2,1H3,(H,24,26)/t12-,14-,15-/m1/s1 |
| InChIKey | SLAFFOKWCBLBEQ-BPLDGKMQSA-N |
| XLogP | 3.09 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|