C13H18N2 — CID 171061003
(4aR,9bS)-2,9-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (PubChem CID 171061003) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (4aR,9bS)-2,9-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aR,9bS)-2,9-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 171061003 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (4aR,9bS)-2,9-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| SMILES | Cc1cccc2c1[C@H]1CN(C)CC[C@H]1N2 |
| InChI | InChI=1S/C13H18N2/c1-9-4-3-5-12-13(9)10-8-15(2)7-6-11(10)14-12/h3-5,10-11,14H,6-8H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | KAIMUXAOIZIQTK-WDEREUQCSA-N |
| XLogP | 2.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |