C28H32O2 — CID 171061210
2,6-ditert-butyl-4-[(2-phenylmethoxyphenyl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 171061210) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2-phenylmethoxyphenyl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(2-phenylmethoxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 171061210 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2-phenylmethoxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=Cc2ccccc2OCc2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C28H32O2/c1-27(2,3)23-17-21(18-24(26(23)29)28(4,5)6)16-22-14-10-11-15-25(22)30-19-20-12-8-7-9-13-20/h7-18H,19H2,1-6H3 |
| InChIKey | OQFVLNNSBDEUSR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'} |
|---|