C24H17BrClN3O3S — CID 171061258
2-(4-bromophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]chromen-4-one (PubChem CID 171061258) has the molecular formula C24H17BrClN3O3S and a molecular weight of 542.84 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]chromen-4-one.
| Compound Name | 2-(4-bromophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]chromen-4-one |
|---|---|
| PubChem CID | 171061258 |
| Molecular Formula | C24H17BrClN3O3S |
| Molecular Weight | 542.84 g/mol |
| Exact Mass | 540.99 |
| IUPAC Name | 2-(4-bromophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]chromen-4-one |
| SMILES | O=c1c(OCCCSc2nnc3c(Cl)cccn23)c(-c2ccc(Br)cc2)oc2ccccc12 |
| InChI | InChI=1S/C24H17BrClN3O3S/c25-16-10-8-15(9-11-16)21-22(20(30)17-5-1-2-7-19(17)32-21)31-13-4-14-33-24-28-27-23-18(26)6-3-12-29(23)24/h1-3,5-12H,4,13-14H2 |
| InChIKey | MNOABGNOGNVNBC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.84 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|