C25H19Cl2N3O4S — CID 171061277
2-(4-chlorophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxychromen-4-one (PubChem CID 171061277) has the molecular formula C25H19Cl2N3O4S and a molecular weight of 528.42 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxychromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxychromen-4-one |
|---|---|
| PubChem CID | 171061277 |
| Molecular Formula | C25H19Cl2N3O4S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[3-[(8-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]propoxy]-7-methoxychromen-4-one |
| SMILES | COc1ccc2c(=O)c(OCCCSc3nnc4c(Cl)cccn34)c(-c3ccc(Cl)cc3)oc2c1 |
| InChI | InChI=1S/C25H19Cl2N3O4S/c1-32-17-9-10-18-20(14-17)34-22(15-5-7-16(26)8-6-15)23(21(18)31)33-12-3-13-35-25-29-28-24-19(27)4-2-11-30(24)25/h2,4-11,14H,3,12-13H2,1H3 |
| InChIKey | XIDLZUZYPLZCCX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|