C17H16ClF2NO2 — CID 171062182
1-[4-[(4-chlorophenyl)methoxy]-2,5-difluorophenyl]pyrrolidin-3-ol (PubChem CID 171062182) has the molecular formula C17H16ClF2NO2 and a molecular weight of 339.77 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methoxy]-2,5-difluorophenyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-[(4-chlorophenyl)methoxy]-2,5-difluorophenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 171062182 |
| Molecular Formula | C17H16ClF2NO2 |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methoxy]-2,5-difluorophenyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2cc(F)c(OCc3ccc(Cl)cc3)cc2F)C1 |
| InChI | InChI=1S/C17H16ClF2NO2/c18-12-3-1-11(2-4-12)10-23-17-8-14(19)16(7-15(17)20)21-6-5-13(22)9-21/h1-4,7-8,13,22H,5-6,9-10H2 |
| InChIKey | YQTWCBYZVANTNO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|