C12H15N3 — CID 171064678
4-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-6-amine (PubChem CID 171064678) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-6-amine.
| Compound Name | 4-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-6-amine |
|---|---|
| PubChem CID | 171064678 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-6-amine |
| SMILES | CC1CCCn2c1nc1c(N)cccc12 |
| InChI | InChI=1S/C12H15N3/c1-8-4-3-7-15-10-6-2-5-9(13)11(10)14-12(8)15/h2,5-6,8H,3-4,7,13H2,1H3 |
| InChIKey | PUPAWDACPGCRAR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|