C29H24ClF6N5O3 — CID 171065896
N-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide (PubChem CID 171065896) has the molecular formula C29H24ClF6N5O3 and a molecular weight of 639.98 g/mol. Its IUPAC name is N-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 171065896 |
| Molecular Formula | C29H24ClF6N5O3 |
| Molecular Weight | 639.98 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | N-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1ccc2c(c1)nc(NCCOCCCCN(Cc1ccc(OC(F)(F)F)c(Cl)c1)C(=O)C(F)(F)F)c1ccncc12 |
| InChI | InChI=1S/C29H24ClF6N5O3/c30-23-13-19(4-6-25(23)44-29(34,35)36)17-41(27(42)28(31,32)33)10-1-2-11-43-12-9-39-26-21-7-8-38-16-22(21)20-5-3-18(15-37)14-24(20)40-26/h3-8,13-14,16H,1-2,9-12,17H2,(H,39,40) |
| InChIKey | KEJLXJYQBRUHCD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.98 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|