C29H27ClF3N5O3 — CID 171065936
N-[[3-chloro-5-(hydroxymethyl)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide (PubChem CID 171065936) has the molecular formula C29H27ClF3N5O3 and a molecular weight of 586.01 g/mol. Its IUPAC name is N-[[3-chloro-5-(hydroxymethyl)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[3-chloro-5-(hydroxymethyl)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 171065936 |
| Molecular Formula | C29H27ClF3N5O3 |
| Molecular Weight | 586.01 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | N-[[3-chloro-5-(hydroxymethyl)phenyl]methyl]-N-[4-[2-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]ethoxy]butyl]-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1ccc2c(c1)nc(NCCOCCCCN(Cc1cc(Cl)cc(CO)c1)C(=O)C(F)(F)F)c1ccncc12 |
| InChI | InChI=1S/C29H27ClF3N5O3/c30-22-12-20(11-21(13-22)18-39)17-38(28(40)29(31,32)33)8-1-2-9-41-10-7-36-27-24-5-6-35-16-25(24)23-4-3-19(15-34)14-26(23)37-27/h3-6,11-14,16,39H,1-2,7-10,17-18H2,(H,36,37) |
| InChIKey | BTOPUGXZTCDWHI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|