C30H34ClF3N7OP — CID 171065951
5-[[7-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-3-ethylheptyl]amino]-N-imino-N'-phosphanylbenzo[c][2,6]naphthyridine-8-carboximidamide (PubChem CID 171065951) has the molecular formula C30H34ClF3N7OP and a molecular weight of 632.07 g/mol. Its IUPAC name is 5-[[7-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-3-ethylheptyl]amino]-N-imino-N'-phosphanylbenzo[c][2,6]naphthyridine-8-carboximidamide.
| Compound Name | 5-[[7-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-3-ethylheptyl]amino]-N-imino-N'-phosphanylbenzo[c][2,6]naphthyridine-8-carboximidamide |
|---|---|
| PubChem CID | 171065951 |
| Molecular Formula | C30H34ClF3N7OP |
| Molecular Weight | 632.07 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 5-[[7-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-3-ethylheptyl]amino]-N-imino-N'-phosphanylbenzo[c][2,6]naphthyridine-8-carboximidamide |
| SMILES | [H]/N=N/C(=N\P)c1ccc2c(c1)nc(NCCC(CC)CCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C30H34ClF3N7OP/c1-2-19(5-3-4-12-36-17-20-6-9-27(25(31)15-20)42-30(32,33)34)10-14-38-29-23-11-13-37-18-24(23)22-8-7-21(16-26(22)39-29)28(40-35)41-43/h6-9,11,13,15-16,18-19,35-36H,2-5,10,12,14,17,43H2,1H3,(H,38,39)/b40-35+,41-28- |
| InChIKey | DYTLEWRYWVAGKF-USXIUVPRSA-N |
| XLogP | 8.69 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.07 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|