C28H26ClF3N4O4 — CID 171065989
5-[(3R)-3-[3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]propoxy]pyrrolidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171065989) has the molecular formula C28H26ClF3N4O4 and a molecular weight of 574.99 g/mol. Its IUPAC name is 5-[(3R)-3-[3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]propoxy]pyrrolidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[(3R)-3-[3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]propoxy]pyrrolidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171065989 |
| Molecular Formula | C28H26ClF3N4O4 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 5-[(3R)-3-[3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]propoxy]pyrrolidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(N1CC[C@@H](OCCCNCc3ccc(OC(F)(F)F)c(Cl)c3)C1)c1ccncc12 |
| InChI | InChI=1S/C28H26ClF3N4O4/c29-23-12-17(2-5-25(23)40-28(30,31)32)14-33-8-1-11-39-19-7-10-36(16-19)26-21-6-9-34-15-22(21)20-4-3-18(27(37)38)13-24(20)35-26/h2-6,9,12-13,15,19,33H,1,7-8,10-11,14,16H2,(H,37,38)/t19-/m1/s1 |
| InChIKey | JNMXVLNAQSLQFN-LJQANCHMSA-N |
| XLogP | 5.81 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|