C27H22ClF3N6O2 — CID 171065999
3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]propyl]prop-2-enamide (PubChem CID 171065999) has the molecular formula C27H22ClF3N6O2 and a molecular weight of 554.96 g/mol. Its IUPAC name is 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]propyl]prop-2-enamide.
| Compound Name | 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 171065999 |
| Molecular Formula | C27H22ClF3N6O2 |
| Molecular Weight | 554.96 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[(8-cyanobenzo[c][2,6]naphthyridin-5-yl)amino]propyl]prop-2-enamide |
| SMILES | N#Cc1ccc2c(c1)nc(NCCCNC(=O)C=CNCc1ccc(OC(F)(F)F)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C27H22ClF3N6O2/c28-22-12-18(3-5-24(22)39-27(29,30)31)15-33-11-7-25(38)35-8-1-9-36-26-20-6-10-34-16-21(20)19-4-2-17(14-32)13-23(19)37-26/h2-7,10-13,16,33H,1,8-9,15H2,(H,35,38)(H,36,37) |
| InChIKey | YNLQHFVHOHZUSG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.96 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|