C32H33ClN6O — CID 171066016
5-[2-[4-[(3-chloro-4-phenylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066016) has the molecular formula C32H33ClN6O and a molecular weight of 553.11 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-phenylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-chloro-4-phenylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066016 |
| Molecular Formula | C32H33ClN6O |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-phenylphenyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCNCCCCNCc1ccc(-c3ccccc3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C32H33ClN6O/c33-29-18-22(8-10-25(29)23-6-2-1-3-7-23)20-36-14-5-4-13-35-16-17-38-32-27-12-15-37-21-28(27)26-11-9-24(31(34)40)19-30(26)39-32/h1-3,6-12,15,18-19,21,35-36H,4-5,13-14,16-17,20H2,(H2,34,40)(H,38,39) |
| InChIKey | UDMMSRACJKZLOJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|