C28H31N7O2 — CID 171066121
5-[3-[3-[(5-cyclopropyl-2-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066121) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 5-[3-[3-[(5-cyclopropyl-2-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[3-[3-[(5-cyclopropyl-2-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066121 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 5-[3-[3-[(5-cyclopropyl-2-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCCNC(=O)CCNCc1ccc(C3CC3)cn1)c1ccncc12 |
| InChI | InChI=1S/C28H31N7O2/c29-27(37)19-5-7-22-24-17-31-12-8-23(24)28(35-25(22)14-19)33-11-1-10-32-26(36)9-13-30-16-21-6-4-20(15-34-21)18-2-3-18/h4-8,12,14-15,17-18,30H,1-3,9-11,13,16H2,(H2,29,37)(H,32,36)(H,33,35) |
| InChIKey | XYRWHYKUANHBLT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|