C32H30ClN5O3 — CID 171066148
5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171066148) has the molecular formula C32H30ClN5O3 and a molecular weight of 568.08 g/mol. Its IUPAC name is 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171066148 |
| Molecular Formula | C32H30ClN5O3 |
| Molecular Weight | 568.08 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(CCNCc1ccc(-c2ccccc2)c(Cl)c1)NCCCNc1nc2cc(C(=O)O)ccc2c2cnccc12 |
| InChI | InChI=1S/C32H30ClN5O3/c33-28-17-21(7-9-24(28)22-5-2-1-3-6-22)19-34-16-12-30(39)36-13-4-14-37-31-26-11-15-35-20-27(26)25-10-8-23(32(40)41)18-29(25)38-31/h1-3,5-11,15,17-18,20,34H,4,12-14,16,19H2,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | BWLPEACXWIKMOE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.08 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|