C32H31ClN6O2 — CID 171066169
5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066169) has the molecular formula C32H31ClN6O2 and a molecular weight of 567.09 g/mol. Its IUPAC name is 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066169 |
| Molecular Formula | C32H31ClN6O2 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 5-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCCNC(=O)CCNCc1ccc(-c3ccccc3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C32H31ClN6O2/c33-28-17-21(7-9-24(28)22-5-2-1-3-6-22)19-35-16-12-30(40)37-13-4-14-38-32-26-11-15-36-20-27(26)25-10-8-23(31(34)41)18-29(25)39-32/h1-3,5-11,15,17-18,20,35H,4,12-14,16,19H2,(H2,34,41)(H,37,40)(H,38,39) |
| InChIKey | ZCPXFXWZHPNUFT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|