C27H24ClF3N8O2 — CID 171066179
5-[2-[5-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066179) has the molecular formula C27H24ClF3N8O2 and a molecular weight of 584.99 g/mol. Its IUPAC name is 5-[2-[5-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[5-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066179 |
| Molecular Formula | C27H24ClF3N8O2 |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 5-[2-[5-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCc1n[nH]c(CCNCc3ccc(OC(F)(F)F)c(Cl)c3)n1)c1ccncc12 |
| InChI | InChI=1S/C27H24ClF3N8O2/c28-20-11-15(1-4-22(20)41-27(29,30)31)13-33-9-6-23-37-24(39-38-23)7-10-35-26-18-5-8-34-14-19(18)17-3-2-16(25(32)40)12-21(17)36-26/h1-5,8,11-12,14,33H,6-7,9-10,13H2,(H2,32,40)(H,35,36)(H,37,38,39) |
| InChIKey | OMGALOWRFINNPU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|