C32H29ClN8O — CID 171066338
5-[2-[5-[2-[(3-chloro-4-phenylphenyl)methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066338) has the molecular formula C32H29ClN8O and a molecular weight of 577.09 g/mol. Its IUPAC name is 5-[2-[5-[2-[(3-chloro-4-phenylphenyl)methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[5-[2-[(3-chloro-4-phenylphenyl)methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066338 |
| Molecular Formula | C32H29ClN8O |
| Molecular Weight | 577.09 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 5-[2-[5-[2-[(3-chloro-4-phenylphenyl)methylamino]ethyl]-1H-1,2,4-triazol-3-yl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCc1n[nH]c(CCNCc3ccc(-c4ccccc4)c(Cl)c3)n1)c1ccncc12 |
| InChI | InChI=1S/C32H29ClN8O/c33-27-16-20(6-8-23(27)21-4-2-1-3-5-21)18-35-14-11-29-39-30(41-40-29)12-15-37-32-25-10-13-36-19-26(25)24-9-7-22(31(34)42)17-28(24)38-32/h1-10,13,16-17,19,35H,11-12,14-15,18H2,(H2,34,42)(H,37,38)(H,39,40,41) |
| InChIKey | LLFOCYMCJIOCAL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|