C27H23ClF3N9O2 — CID 171066351
3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[[8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-yl]amino]propyl]prop-2-enamide (PubChem CID 171066351) has the molecular formula C27H23ClF3N9O2 and a molecular weight of 597.99 g/mol. Its IUPAC name is 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[[8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-yl]amino]propyl]prop-2-enamide.
| Compound Name | 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[[8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-yl]amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 171066351 |
| Molecular Formula | C27H23ClF3N9O2 |
| Molecular Weight | 597.99 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 3-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]-N-[3-[[8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-yl]amino]propyl]prop-2-enamide |
| SMILES | O=C(C=CNCc1ccc(OC(F)(F)F)c(Cl)c1)NCCCNc1nc2cc(-c3nn[nH]n3)ccc2c2cnccc12 |
| InChI | InChI=1S/C27H23ClF3N9O2/c28-21-12-16(2-5-23(21)42-27(29,30)31)14-32-11-7-24(41)34-8-1-9-35-26-19-6-10-33-15-20(19)18-4-3-17(13-22(18)36-26)25-37-39-40-38-25/h2-7,10-13,15,32H,1,8-9,14H2,(H,34,41)(H,35,36)(H,37,38,39,40) |
| InChIKey | PLDVCANBUQRJFA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|