C30H28ClN5O2 — CID 171066549
5-[2-[2-[(3-chloro-4-phenylphenyl)methylamino]ethylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171066549) has the molecular formula C30H28ClN5O2 and a molecular weight of 526.04 g/mol. Its IUPAC name is 5-[2-[2-[(3-chloro-4-phenylphenyl)methylamino]ethylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[2-[(3-chloro-4-phenylphenyl)methylamino]ethylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171066549 |
| Molecular Formula | C30H28ClN5O2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 5-[2-[2-[(3-chloro-4-phenylphenyl)methylamino]ethylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NCCNCCNCc1ccc(-c3ccccc3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C30H28ClN5O2/c31-27-16-20(6-8-23(27)21-4-2-1-3-5-21)18-34-13-12-32-14-15-35-29-25-10-11-33-19-26(25)24-9-7-22(30(37)38)17-28(24)36-29/h1-11,16-17,19,32,34H,12-15,18H2,(H,35,36)(H,37,38) |
| InChIKey | NUZZUWIZRAPOCJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|